C16H15N3O5S2 — CID 75465176
methyl 4-(5,6-dicarbamoyl-2-oxo-3,5,6,7-tetrahydrothiopyrano[2,3-d][1,3]thiazol-7-yl)benzoate (PubChem CID 75465176) has the molecular formula C16H15N3O5S2 and a molecular weight of 393.45 g/mol. Its IUPAC name is methyl 4-(5,6-dicarbamoyl-2-oxo-3,5,6,7-tetrahydrothiopyrano[2,3-d][1,3]thiazol-7-yl)benzoate.
| Compound Name | methyl 4-(5,6-dicarbamoyl-2-oxo-3,5,6,7-tetrahydrothiopyrano[2,3-d][1,3]thiazol-7-yl)benzoate |
|---|---|
| PubChem CID | 75465176 |
| Molecular Formula | C16H15N3O5S2 |
| Molecular Weight | 393.45 g/mol |
| Exact Mass | 393.05 |
| IUPAC Name | methyl 4-(5,6-dicarbamoyl-2-oxo-3,5,6,7-tetrahydrothiopyrano[2,3-d][1,3]thiazol-7-yl)benzoate |
| SMILES | COC(=O)c1ccc(C2c3sc(=O)[nH]c3SC(C(N)=O)C2C(N)=O)cc1 |
| InChI | InChI=1S/C16H15N3O5S2/c1-24-15(22)7-4-2-6(3-5-7)8-9(12(17)20)10(13(18)21)25-14-11(8)26-16(23)19-14/h2-5,8-10H,1H3,(H2,17,20)(H2,18,21)(H,19,23) |
| InChIKey | FDRDLEDRBRPMKE-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 145.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.45 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'} |
|---|