C16H10NO7S2- — CID 6592337
(1S,10S,11S)-4-methoxycarbonyl-9,15-dioxo-8-oxa-12,16-dithia-14-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2(7),3,5,13(17)-tetraene-11-carboxylate (PubChem CID 6592337) has the molecular formula C16H10NO7S2- and a molecular weight of 392.39 g/mol. Its IUPAC name is (1S,10S,11S)-4-methoxycarbonyl-9,15-dioxo-8-oxa-12,16-dithia-14-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2(7),3,5,13(17)-tetraene-11-carboxylate.
| Compound Name | (1S,10S,11S)-4-methoxycarbonyl-9,15-dioxo-8-oxa-12,16-dithia-14-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2(7),3,5,13(17)-tetraene-11-carboxylate |
|---|---|
| PubChem CID | 6592337 |
| Molecular Formula | C16H10NO7S2- |
| Molecular Weight | 392.39 g/mol |
| Exact Mass | 391.99 |
| IUPAC Name | (1S,10S,11S)-4-methoxycarbonyl-9,15-dioxo-8-oxa-12,16-dithia-14-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2(7),3,5,13(17)-tetraene-11-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)[C@H]1c3sc(=O)[nH]c3S[C@H](C(=O)[O-])[C@@H]1C(=O)O2 |
| InChI | InChI=1S/C16H11NO7S2/c1-23-14(20)5-2-3-7-6(4-5)8-9(15(21)24-7)11(13(18)19)25-12-10(8)26-16(22)17-12/h2-4,8-9,11H,1H3,(H,17,22)(H,18,19)/p-1/t8-,9-,11+/m1/s1 |
| InChIKey | OZSFXFHRKLQVDC-KKZNHRDASA-M |
| XLogP | 0.11 |
| TPSA | 125.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.39 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|