C21H17NO3S2 — CID 11920805
methyl 4-[(1S,9R,16S)-13-oxo-10,14-dithia-12-azatetracyclo[7.7.0.02,7.011,15]hexadeca-2,4,6,11(15)-tetraen-16-yl]benzoate (PubChem CID 11920805) has the molecular formula C21H17NO3S2 and a molecular weight of 395.51 g/mol. Its IUPAC name is methyl 4-[(1S,9R,16S)-13-oxo-10,14-dithia-12-azatetracyclo[7.7.0.02,7.011,15]hexadeca-2,4,6,11(15)-tetraen-16-yl]benzoate.
| Compound Name | methyl 4-[(1S,9R,16S)-13-oxo-10,14-dithia-12-azatetracyclo[7.7.0.02,7.011,15]hexadeca-2,4,6,11(15)-tetraen-16-yl]benzoate |
|---|---|
| PubChem CID | 11920805 |
| Molecular Formula | C21H17NO3S2 |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.06 |
| IUPAC Name | methyl 4-[(1S,9R,16S)-13-oxo-10,14-dithia-12-azatetracyclo[7.7.0.02,7.011,15]hexadeca-2,4,6,11(15)-tetraen-16-yl]benzoate |
| SMILES | COC(=O)c1ccc([C@H]2c3sc(=O)[nH]c3S[C@@H]3Cc4ccccc4[C@H]23)cc1 |
| InChI | InChI=1S/C21H17NO3S2/c1-25-20(23)12-8-6-11(7-9-12)16-17-14-5-3-2-4-13(14)10-15(17)26-19-18(16)27-21(24)22-19/h2-9,15-17H,10H2,1H3,(H,22,24)/t15-,16-,17+/m1/s1 |
| InChIKey | DBNZSTWAWLVZQS-ZACQAIPSSA-N |
| XLogP | 4.17 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'} |
|---|