C16H13NO5S2 — CID 99796400
ethyl (1R,10S,11R)-9,15-dioxo-8-oxa-12,16-dithia-14-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2,4,6,13(17)-tetraene-11-carboxylate (PubChem CID 99796400) has the molecular formula C16H13NO5S2 and a molecular weight of 363.42 g/mol. Its IUPAC name is ethyl (1R,10S,11R)-9,15-dioxo-8-oxa-12,16-dithia-14-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2,4,6,13(17)-tetraene-11-carboxylate.
| Compound Name | ethyl (1R,10S,11R)-9,15-dioxo-8-oxa-12,16-dithia-14-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2,4,6,13(17)-tetraene-11-carboxylate |
|---|---|
| PubChem CID | 99796400 |
| Molecular Formula | C16H13NO5S2 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.02 |
| IUPAC Name | ethyl (1R,10S,11R)-9,15-dioxo-8-oxa-12,16-dithia-14-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2,4,6,13(17)-tetraene-11-carboxylate |
| SMILES | CCOC(=O)[C@@H]1Sc2[nH]c(=O)sc2[C@H]2c3ccccc3OC(=O)[C@H]21 |
| InChI | InChI=1S/C16H13NO5S2/c1-2-21-15(19)12-10-9(11-13(23-12)17-16(20)24-11)7-5-3-4-6-8(7)22-14(10)18/h3-6,9-10,12H,2H2,1H3,(H,17,20)/t9-,10+,12+/m0/s1 |
| InChIKey | HDHIZXDDRJMVJT-HOSYDEDBSA-N |
| XLogP | 2.14 |
| TPSA | 85.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|