C16H15NO4S2 — CID 75465161
ethyl 15-oxo-8-oxa-12,16-dithia-14-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2,4,6,13(17)-tetraene-11-carboxylate (PubChem CID 75465161) has the molecular formula C16H15NO4S2 and a molecular weight of 349.43 g/mol. Its IUPAC name is ethyl 15-oxo-8-oxa-12,16-dithia-14-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2,4,6,13(17)-tetraene-11-carboxylate.
| Compound Name | ethyl 15-oxo-8-oxa-12,16-dithia-14-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2,4,6,13(17)-tetraene-11-carboxylate |
|---|---|
| PubChem CID | 75465161 |
| Molecular Formula | C16H15NO4S2 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.04 |
| IUPAC Name | ethyl 15-oxo-8-oxa-12,16-dithia-14-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2,4,6,13(17)-tetraene-11-carboxylate |
| SMILES | CCOC(=O)C1Sc2[nH]c(=O)sc2C2c3ccccc3OCC12 |
| InChI | InChI=1S/C16H15NO4S2/c1-2-20-15(18)12-9-7-21-10-6-4-3-5-8(10)11(9)13-14(22-12)17-16(19)23-13/h3-6,9,11-12H,2,7H2,1H3,(H,17,19) |
| InChIKey | ZVUHFYBRYGQWEC-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 68.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'} |
|---|