C13H13NO3S3 — CID 39835936
ethyl (6R,7R)-2-oxo-7-thiophen-2-yl-3,5,6,7-tetrahydrothiopyrano[2,3-d][1,3]thiazole-6-carboxylate (PubChem CID 39835936) has the molecular formula C13H13NO3S3 and a molecular weight of 327.45 g/mol. Its IUPAC name is ethyl (6R,7R)-2-oxo-7-thiophen-2-yl-3,5,6,7-tetrahydrothiopyrano[2,3-d][1,3]thiazole-6-carboxylate.
| Compound Name | ethyl (6R,7R)-2-oxo-7-thiophen-2-yl-3,5,6,7-tetrahydrothiopyrano[2,3-d][1,3]thiazole-6-carboxylate |
|---|---|
| PubChem CID | 39835936 |
| Molecular Formula | C13H13NO3S3 |
| Molecular Weight | 327.45 g/mol |
| Exact Mass | 327.01 |
| IUPAC Name | ethyl (6R,7R)-2-oxo-7-thiophen-2-yl-3,5,6,7-tetrahydrothiopyrano[2,3-d][1,3]thiazole-6-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CSc2[nH]c(=O)sc2[C@H]1c1cccs1 |
| InChI | InChI=1S/C13H13NO3S3/c1-2-17-12(15)7-6-19-11-10(20-13(16)14-11)9(7)8-4-3-5-18-8/h3-5,7,9H,2,6H2,1H3,(H,14,16)/t7-,9-/m1/s1 |
| InChIKey | FYSMDTUPQISGEP-VXNVDRBHSA-N |
| XLogP | 2.91 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.45 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'} |
|---|