C10H9NO2S3 — CID 154712614
(5S,7S)-5-hydroxy-7-thiophen-2-yl-3,5,6,7-tetrahydrothiopyrano[2,3-d][1,3]thiazol-2-one (PubChem CID 154712614) has the molecular formula C10H9NO2S3 and a molecular weight of 271.39 g/mol. Its IUPAC name is (5S,7S)-5-hydroxy-7-thiophen-2-yl-3,5,6,7-tetrahydrothiopyrano[2,3-d][1,3]thiazol-2-one.
| Compound Name | (5S,7S)-5-hydroxy-7-thiophen-2-yl-3,5,6,7-tetrahydrothiopyrano[2,3-d][1,3]thiazol-2-one |
|---|---|
| PubChem CID | 154712614 |
| Molecular Formula | C10H9NO2S3 |
| Molecular Weight | 271.39 g/mol |
| Exact Mass | 270.98 |
| IUPAC Name | (5S,7S)-5-hydroxy-7-thiophen-2-yl-3,5,6,7-tetrahydrothiopyrano[2,3-d][1,3]thiazol-2-one |
| SMILES | O=c1[nH]c2c(s1)[C@H](c1cccs1)C[C@@H](O)S2 |
| InChI | InChI=1S/C10H9NO2S3/c12-7-4-5(6-2-1-3-14-6)8-9(15-7)11-10(13)16-8/h1-3,5,7,12H,4H2,(H,11,13)/t5-,7-/m0/s1 |
| InChIKey | ODDFDUMXGNXZIV-FSPLSTOPSA-N |
| XLogP | 2.44 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.39 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'} |
|---|