C18H12N2O3S3 — CID 19251646
(1R,8R,9R)-11-phenyl-8-thiophen-2-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione (PubChem CID 19251646) has the molecular formula C18H12N2O3S3 and a molecular weight of 400.51 g/mol. Its IUPAC name is (1R,8R,9R)-11-phenyl-8-thiophen-2-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione.
| Compound Name | (1R,8R,9R)-11-phenyl-8-thiophen-2-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione |
|---|---|
| PubChem CID | 19251646 |
| Molecular Formula | C18H12N2O3S3 |
| Molecular Weight | 400.51 g/mol |
| Exact Mass | 400.00 |
| IUPAC Name | (1R,8R,9R)-11-phenyl-8-thiophen-2-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione |
| SMILES | O=C1[C@H]2[C@H](c3cccs3)c3sc(=O)[nH]c3S[C@H]2C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C18H12N2O3S3/c21-16-12-11(10-7-4-8-24-10)13-15(19-18(23)26-13)25-14(12)17(22)20(16)9-5-2-1-3-6-9/h1-8,11-12,14H,(H,19,23)/t11-,12-,14+/m0/s1 |
| InChIKey | DSSXDTOLNQDRKB-SGMGOOAPSA-N |
| XLogP | 3.29 |
| TPSA | 70.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.51 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|