C21H15ClN2O3S2 — CID 43849918
11-(4-chlorophenyl)-8-(2-methylphenyl)-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione (PubChem CID 43849918) has the molecular formula C21H15ClN2O3S2 and a molecular weight of 442.95 g/mol. Its IUPAC name is 11-(4-chlorophenyl)-8-(2-methylphenyl)-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione.
| Compound Name | 11-(4-chlorophenyl)-8-(2-methylphenyl)-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione |
|---|---|
| PubChem CID | 43849918 |
| Molecular Formula | C21H15ClN2O3S2 |
| Molecular Weight | 442.95 g/mol |
| Exact Mass | 442.02 |
| IUPAC Name | 11-(4-chlorophenyl)-8-(2-methylphenyl)-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione |
| SMILES | Cc1ccccc1C1c2sc(=O)[nH]c2SC2C(=O)N(c3ccc(Cl)cc3)C(=O)C21 |
| InChI | InChI=1S/C21H15ClN2O3S2/c1-10-4-2-3-5-13(10)14-15-17(28-18-16(14)29-21(27)23-18)20(26)24(19(15)25)12-8-6-11(22)7-9-12/h2-9,14-15,17H,1H3,(H,23,27) |
| InChIKey | LNOVRFVRPRYDIJ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 70.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.95 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|