C20H11Cl3N2O3S2 — CID 78578693
(8S)-11-(4-chlorophenyl)-8-(2,3-dichlorophenyl)-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione (PubChem CID 78578693) has the molecular formula C20H11Cl3N2O3S2 and a molecular weight of 497.81 g/mol. Its IUPAC name is (8S)-11-(4-chlorophenyl)-8-(2,3-dichlorophenyl)-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione.
| Compound Name | (8S)-11-(4-chlorophenyl)-8-(2,3-dichlorophenyl)-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione |
|---|---|
| PubChem CID | 78578693 |
| Molecular Formula | C20H11Cl3N2O3S2 |
| Molecular Weight | 497.81 g/mol |
| Exact Mass | 495.93 |
| IUPAC Name | (8S)-11-(4-chlorophenyl)-8-(2,3-dichlorophenyl)-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione |
| SMILES | O=C1C2Sc3[nH]c(=O)sc3[C@H](c3cccc(Cl)c3Cl)C2C(=O)N1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H11Cl3N2O3S2/c21-8-4-6-9(7-5-8)25-18(26)13-12(10-2-1-3-11(22)14(10)23)15-17(24-20(28)30-15)29-16(13)19(25)27/h1-7,12-13,16H,(H,24,28)/t12-,13?,16?/m1/s1 |
| InChIKey | QYWRUVDWNRYRMM-VEAWUBTESA-N |
| XLogP | 5.19 |
| TPSA | 70.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.81 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|