C21H14Cl2N2O4S2 — CID 43850156
8-(2,3-dichlorophenyl)-11-(4-methoxyphenyl)-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione (PubChem CID 43850156) has the molecular formula C21H14Cl2N2O4S2 and a molecular weight of 493.39 g/mol. Its IUPAC name is 8-(2,3-dichlorophenyl)-11-(4-methoxyphenyl)-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione.
| Compound Name | 8-(2,3-dichlorophenyl)-11-(4-methoxyphenyl)-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione |
|---|---|
| PubChem CID | 43850156 |
| Molecular Formula | C21H14Cl2N2O4S2 |
| Molecular Weight | 493.39 g/mol |
| Exact Mass | 491.98 |
| IUPAC Name | 8-(2,3-dichlorophenyl)-11-(4-methoxyphenyl)-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione |
| SMILES | COc1ccc(N2C(=O)C3Sc4[nH]c(=O)sc4C(c4cccc(Cl)c4Cl)C3C2=O)cc1 |
| InChI | InChI=1S/C21H14Cl2N2O4S2/c1-29-10-7-5-9(6-8-10)25-19(26)14-13(11-3-2-4-12(22)15(11)23)16-18(24-21(28)31-16)30-17(14)20(25)27/h2-8,13-14,17H,1H3,(H,24,28) |
| InChIKey | IUEHMWVGEUQHMU-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 79.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.39 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|