C19H14N2O5S2 — CID 43850176
8-(furan-2-yl)-11-(4-methoxyphenyl)-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione (PubChem CID 43850176) has the molecular formula C19H14N2O5S2 and a molecular weight of 414.46 g/mol. Its IUPAC name is 8-(furan-2-yl)-11-(4-methoxyphenyl)-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione.
| Compound Name | 8-(furan-2-yl)-11-(4-methoxyphenyl)-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione |
|---|---|
| PubChem CID | 43850176 |
| Molecular Formula | C19H14N2O5S2 |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.03 |
| IUPAC Name | 8-(furan-2-yl)-11-(4-methoxyphenyl)-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione |
| SMILES | COc1ccc(N2C(=O)C3Sc4[nH]c(=O)sc4C(c4ccco4)C3C2=O)cc1 |
| InChI | InChI=1S/C19H14N2O5S2/c1-25-10-6-4-9(5-7-10)21-17(22)13-12(11-3-2-8-26-11)14-16(20-19(24)28-14)27-15(13)18(21)23/h2-8,12-13,15H,1H3,(H,20,24) |
| InChIKey | ALZLRQKIQLGOHQ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 92.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|