C26H21ClN2O3S2 — CID 176535676
(1R,11S)-14-(4-chlorophenyl)-9-(2-methylphenyl)-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione (PubChem CID 176535676) has the molecular formula C26H21ClN2O3S2 and a molecular weight of 509.05 g/mol. Its IUPAC name is (1R,11S)-14-(4-chlorophenyl)-9-(2-methylphenyl)-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione.
| Compound Name | (1R,11S)-14-(4-chlorophenyl)-9-(2-methylphenyl)-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione |
|---|---|
| PubChem CID | 176535676 |
| Molecular Formula | C26H21ClN2O3S2 |
| Molecular Weight | 509.05 g/mol |
| Exact Mass | 508.07 |
| IUPAC Name | (1R,11S)-14-(4-chlorophenyl)-9-(2-methylphenyl)-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione |
| SMILES | Cc1ccccc1C1c2sc(=O)[nH]c2SC2C1[C@H]1C[C@@H]2C2C(=O)N(c3ccc(Cl)cc3)C(=O)C21 |
| InChI | InChI=1S/C26H21ClN2O3S2/c1-11-4-2-3-5-14(11)17-18-15-10-16(21(18)33-23-22(17)34-26(32)28-23)20-19(15)24(30)29(25(20)31)13-8-6-12(27)7-9-13/h2-9,15-21H,10H2,1H3,(H,28,32)/t15-,16-,17?,18?,19?,20?,21?/m1/s1 |
| InChIKey | UNWPMXFHGXEETN-HXWHIOKKSA-N |
| XLogP | 5.08 |
| TPSA | 70.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.05 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|