C24H20N2O4S3 — CID 16557937
14-(4-methoxyphenyl)-9-thiophen-2-yl-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione (PubChem CID 16557937) has the molecular formula C24H20N2O4S3 and a molecular weight of 496.64 g/mol. Its IUPAC name is 14-(4-methoxyphenyl)-9-thiophen-2-yl-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione.
| Compound Name | 14-(4-methoxyphenyl)-9-thiophen-2-yl-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione |
|---|---|
| PubChem CID | 16557937 |
| Molecular Formula | C24H20N2O4S3 |
| Molecular Weight | 496.64 g/mol |
| Exact Mass | 496.06 |
| IUPAC Name | 14-(4-methoxyphenyl)-9-thiophen-2-yl-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione |
| SMILES | COc1ccc(N2C(=O)C3C4CC(C3C2=O)C2C(c3cccs3)c3sc(=O)[nH]c3SC42)cc1 |
| InChI | InChI=1S/C24H20N2O4S3/c1-30-11-6-4-10(5-7-11)26-22(27)16-12-9-13(17(16)23(26)28)19-15(12)18(14-3-2-8-31-14)20-21(32-19)25-24(29)33-20/h2-8,12-13,15-19H,9H2,1H3,(H,25,29) |
| InChIKey | OXKPUSXFCNYCNJ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 79.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.64 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|