C11H13NO3 — CID 22882442
ethyl (3R)-3,4-dihydro-2H-1,4-benzoxazine-3-carboxylate (PubChem CID 22882442) has the molecular formula C11H13NO3 and a molecular weight of 207.23 g/mol. Its IUPAC name is ethyl (3R)-3,4-dihydro-2H-1,4-benzoxazine-3-carboxylate.
| Compound Name | ethyl (3R)-3,4-dihydro-2H-1,4-benzoxazine-3-carboxylate |
|---|---|
| PubChem CID | 22882442 |
| Molecular Formula | C11H13NO3 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | ethyl (3R)-3,4-dihydro-2H-1,4-benzoxazine-3-carboxylate |
| SMILES | CCOC(=O)[C@H]1COc2ccccc2N1 |
| InChI | InChI=1S/C11H13NO3/c1-2-14-11(13)9-7-15-10-6-4-3-5-8(10)12-9/h3-6,9,12H,2,7H2,1H3/t9-/m1/s1 |
| InChIKey | LTZYMDXKZIRZKO-SECBINFHSA-N |
| XLogP | 1.42 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |