C13H18NO5P — CID 56629985
(2-ethoxycarbonyl-1,2,3,4-tetrahydroquinolin-4-yl)methylphosphonic acid (PubChem CID 56629985) has the molecular formula C13H18NO5P and a molecular weight of 299.26 g/mol. Its IUPAC name is (2-ethoxycarbonyl-1,2,3,4-tetrahydroquinolin-4-yl)methylphosphonic acid.
| Compound Name | (2-ethoxycarbonyl-1,2,3,4-tetrahydroquinolin-4-yl)methylphosphonic acid |
|---|---|
| PubChem CID | 56629985 |
| Molecular Formula | C13H18NO5P |
| Molecular Weight | 299.26 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | (2-ethoxycarbonyl-1,2,3,4-tetrahydroquinolin-4-yl)methylphosphonic acid |
| SMILES | CCOC(=O)C1CC(CP(=O)(O)O)c2ccccc2N1 |
| InChI | InChI=1S/C13H18NO5P/c1-2-19-13(15)12-7-9(8-20(16,17)18)10-5-3-4-6-11(10)14-12/h3-6,9,12,14H,2,7-8H2,1H3,(H2,16,17,18) |
| InChIKey | BCMIOSVMTNQTKH-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.26 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|