C13H17NO3 — CID 10776114
ethyl (2S,5R)-5-(2-hydroxyphenyl)pyrrolidine-2-carboxylate (PubChem CID 10776114) has the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. Its IUPAC name is ethyl (2S,5R)-5-(2-hydroxyphenyl)pyrrolidine-2-carboxylate.
| Compound Name | ethyl (2S,5R)-5-(2-hydroxyphenyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 10776114 |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | ethyl (2S,5R)-5-(2-hydroxyphenyl)pyrrolidine-2-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CC[C@H](c2ccccc2O)N1 |
| InChI | InChI=1S/C13H17NO3/c1-2-17-13(16)11-8-7-10(14-11)9-5-3-4-6-12(9)15/h3-6,10-11,14-15H,2,7-8H2,1H3/t10-,11+/m1/s1 |
| InChIKey | IOWZYDFRRJDILX-MNOVXSKESA-N |
| XLogP | 1.75 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|