C13H16FNO2 — CID 131887910
ethyl (2R,5S)-5-(3-fluorophenyl)pyrrolidine-2-carboxylate (PubChem CID 131887910) has the molecular formula C13H16FNO2 and a molecular weight of 237.27 g/mol. Its IUPAC name is ethyl (2R,5S)-5-(3-fluorophenyl)pyrrolidine-2-carboxylate.
| Compound Name | ethyl (2R,5S)-5-(3-fluorophenyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 131887910 |
| Molecular Formula | C13H16FNO2 |
| Molecular Weight | 237.27 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | ethyl (2R,5S)-5-(3-fluorophenyl)pyrrolidine-2-carboxylate |
| SMILES | CCOC(=O)[C@H]1CC[C@@H](c2cccc(F)c2)N1 |
| InChI | InChI=1S/C13H16FNO2/c1-2-17-13(16)12-7-6-11(15-12)9-4-3-5-10(14)8-9/h3-5,8,11-12,15H,2,6-7H2,1H3/t11-,12+/m0/s1 |
| InChIKey | ZJJRVEFTBJTCJU-NWDGAFQWSA-N |
| XLogP | 2.18 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.27 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |