C20H13FN2O4S2 — CID 35581437
(1R,10R,11R)-N-(4-fluorophenyl)-9,15-dioxo-8-oxa-12,16-dithia-14-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2,4,6,13(17)-tetraene-11-carboxamide (PubChem CID 35581437) has the molecular formula C20H13FN2O4S2 and a molecular weight of 428.47 g/mol. Its IUPAC name is (1R,10R,11R)-N-(4-fluorophenyl)-9,15-dioxo-8-oxa-12,16-dithia-14-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2,4,6,13(17)-tetraene-11-carboxamide.
| Compound Name | (1R,10R,11R)-N-(4-fluorophenyl)-9,15-dioxo-8-oxa-12,16-dithia-14-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2,4,6,13(17)-tetraene-11-carboxamide |
|---|---|
| PubChem CID | 35581437 |
| Molecular Formula | C20H13FN2O4S2 |
| Molecular Weight | 428.47 g/mol |
| Exact Mass | 428.03 |
| IUPAC Name | (1R,10R,11R)-N-(4-fluorophenyl)-9,15-dioxo-8-oxa-12,16-dithia-14-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2,4,6,13(17)-tetraene-11-carboxamide |
| SMILES | O=C1Oc2ccccc2[C@@H]2c3sc(=O)[nH]c3S[C@@H](C(=O)Nc3ccc(F)cc3)[C@@H]12 |
| InChI | InChI=1S/C20H13FN2O4S2/c21-9-5-7-10(8-6-9)22-17(24)15-14-13(16-18(28-15)23-20(26)29-16)11-3-1-2-4-12(11)27-19(14)25/h1-8,13-15H,(H,22,24)(H,23,26)/t13-,14-,15+/m0/s1 |
| InChIKey | OTQVZPBQAZFKFV-SOUVJXGZSA-N |
| XLogP | 3.36 |
| TPSA | 88.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.47 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|