C16H11NO7S2 — CID 4969913
4-methoxycarbonyl-9,15-dioxo-8-oxa-12,16-dithia-14-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2(7),3,5,13(17)-tetraene-11-carboxylic acid (PubChem CID 4969913) has the molecular formula C16H11NO7S2 and a molecular weight of 393.40 g/mol. Its IUPAC name is 4-methoxycarbonyl-9,15-dioxo-8-oxa-12,16-dithia-14-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2(7),3,5,13(17)-tetraene-11-carboxylic acid.
| Compound Name | 4-methoxycarbonyl-9,15-dioxo-8-oxa-12,16-dithia-14-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2(7),3,5,13(17)-tetraene-11-carboxylic acid |
|---|---|
| PubChem CID | 4969913 |
| Molecular Formula | C16H11NO7S2 |
| Molecular Weight | 393.40 g/mol |
| Exact Mass | 393.00 |
| IUPAC Name | 4-methoxycarbonyl-9,15-dioxo-8-oxa-12,16-dithia-14-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2(7),3,5,13(17)-tetraene-11-carboxylic acid |
| SMILES | COC(=O)c1ccc2c(c1)C1c3sc(=O)[nH]c3SC(C(=O)O)C1C(=O)O2 |
| InChI | InChI=1S/C16H11NO7S2/c1-23-14(20)5-2-3-7-6(4-5)8-9(15(21)24-7)11(13(18)19)25-12-10(8)26-16(22)17-12/h2-4,8-9,11H,1H3,(H,17,22)(H,18,19) |
| InChIKey | OZSFXFHRKLQVDC-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 122.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.40 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|