C14H8NO6S2- — CID 6562200
(1S,10R,11S)-5-hydroxy-9,15-dioxo-8-oxa-12,16-dithia-14-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2(7),3,5,13(17)-tetraene-11-carboxylate (PubChem CID 6562200) has the molecular formula C14H8NO6S2- and a molecular weight of 350.35 g/mol. Its IUPAC name is (1S,10R,11S)-5-hydroxy-9,15-dioxo-8-oxa-12,16-dithia-14-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2(7),3,5,13(17)-tetraene-11-carboxylate.
| Compound Name | (1S,10R,11S)-5-hydroxy-9,15-dioxo-8-oxa-12,16-dithia-14-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2(7),3,5,13(17)-tetraene-11-carboxylate |
|---|---|
| PubChem CID | 6562200 |
| Molecular Formula | C14H8NO6S2- |
| Molecular Weight | 350.35 g/mol |
| Exact Mass | 349.98 |
| IUPAC Name | (1S,10R,11S)-5-hydroxy-9,15-dioxo-8-oxa-12,16-dithia-14-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2(7),3,5,13(17)-tetraene-11-carboxylate |
| SMILES | O=C1Oc2cc(O)ccc2[C@H]2c3sc(=O)[nH]c3S[C@H](C(=O)[O-])[C@@H]12 |
| InChI | InChI=1S/C14H9NO6S2/c16-4-1-2-5-6(3-4)21-13(19)8-7(5)9-11(15-14(20)23-9)22-10(8)12(17)18/h1-3,7-8,10,16H,(H,15,20)(H,17,18)/p-1/t7-,8+,10+/m1/s1 |
| InChIKey | XLLALKBLIJIEGD-WEDXCCLWSA-M |
| XLogP | 0.03 |
| TPSA | 119.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.35 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|