C15H15NO3S2 — CID 51428425
(5S,6S,7R)-7-(4-methoxyphenyl)-5-methyl-2-oxo-3,5,6,7-tetrahydrothiopyrano[2,3-d][1,3]thiazole-6-carbaldehyde (PubChem CID 51428425) has the molecular formula C15H15NO3S2 and a molecular weight of 321.42 g/mol. Its IUPAC name is (5S,6S,7R)-7-(4-methoxyphenyl)-5-methyl-2-oxo-3,5,6,7-tetrahydrothiopyrano[2,3-d][1,3]thiazole-6-carbaldehyde.
| Compound Name | (5S,6S,7R)-7-(4-methoxyphenyl)-5-methyl-2-oxo-3,5,6,7-tetrahydrothiopyrano[2,3-d][1,3]thiazole-6-carbaldehyde |
|---|---|
| PubChem CID | 51428425 |
| Molecular Formula | C15H15NO3S2 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.05 |
| IUPAC Name | (5S,6S,7R)-7-(4-methoxyphenyl)-5-methyl-2-oxo-3,5,6,7-tetrahydrothiopyrano[2,3-d][1,3]thiazole-6-carbaldehyde |
| SMILES | COc1ccc([C@@H]2c3sc(=O)[nH]c3S[C@@H](C)[C@@H]2C=O)cc1 |
| InChI | InChI=1S/C15H15NO3S2/c1-8-11(7-17)12(9-3-5-10(19-2)6-4-9)13-14(20-8)16-15(18)21-13/h3-8,11-12H,1-2H3,(H,16,18)/t8-,11-,12-/m0/s1 |
| InChIKey | IUPMNHIVPZGHLG-UWJYBYFXSA-N |
| XLogP | 2.89 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|