C14H13NO2S3 — CID 18866060
7-(4-methoxyphenyl)-2-sulfanylidene-3,5,6,7-tetrahydrothiopyrano[2,3-d][1,3]thiazole-6-carbaldehyde (PubChem CID 18866060) has the molecular formula C14H13NO2S3 and a molecular weight of 323.46 g/mol. Its IUPAC name is 7-(4-methoxyphenyl)-2-sulfanylidene-3,5,6,7-tetrahydrothiopyrano[2,3-d][1,3]thiazole-6-carbaldehyde.
| Compound Name | 7-(4-methoxyphenyl)-2-sulfanylidene-3,5,6,7-tetrahydrothiopyrano[2,3-d][1,3]thiazole-6-carbaldehyde |
|---|---|
| PubChem CID | 18866060 |
| Molecular Formula | C14H13NO2S3 |
| Molecular Weight | 323.46 g/mol |
| Exact Mass | 323.01 |
| IUPAC Name | 7-(4-methoxyphenyl)-2-sulfanylidene-3,5,6,7-tetrahydrothiopyrano[2,3-d][1,3]thiazole-6-carbaldehyde |
| SMILES | COc1ccc(C2c3sc(=S)[nH]c3SCC2C=O)cc1 |
| InChI | InChI=1S/C14H13NO2S3/c1-17-10-4-2-8(3-5-10)11-9(6-16)7-19-13-12(11)20-14(18)15-13/h2-6,9,11H,7H2,1H3,(H,15,18) |
| InChIKey | YEPYVYZAPYAKTO-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.46 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|