C16H13N3O5S2 — CID 124769375
(1S,8R,9R)-8-(4-methoxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-11-carboxamide (PubChem CID 124769375) has the molecular formula C16H13N3O5S2 and a molecular weight of 391.43 g/mol. Its IUPAC name is (1S,8R,9R)-8-(4-methoxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-11-carboxamide.
| Compound Name | (1S,8R,9R)-8-(4-methoxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-11-carboxamide |
|---|---|
| PubChem CID | 124769375 |
| Molecular Formula | C16H13N3O5S2 |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.03 |
| IUPAC Name | (1S,8R,9R)-8-(4-methoxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-11-carboxamide |
| SMILES | COc1ccc([C@@H]2c3sc(=O)[nH]c3S[C@@H]3C(=O)N(C(N)=O)C(=O)[C@@H]23)cc1 |
| InChI | InChI=1S/C16H13N3O5S2/c1-24-7-4-2-6(3-5-7)8-9-11(14(21)19(13(9)20)15(17)22)25-12-10(8)26-16(23)18-12/h2-5,8-9,11H,1H3,(H2,17,22)(H,18,23)/t8-,9-,11-/m0/s1 |
| InChIKey | SPEHWFILQJMAOU-QXEWZRGKSA-N |
| XLogP | 1.11 |
| TPSA | 122.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|