C15H13NO4S2 — CID 132941903
(1R,8R,9R)-8-(4-methoxyphenyl)-11-oxa-2,6-dithia-4-azatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10-dione (PubChem CID 132941903) has the molecular formula C15H13NO4S2 and a molecular weight of 335.41 g/mol. Its IUPAC name is (1R,8R,9R)-8-(4-methoxyphenyl)-11-oxa-2,6-dithia-4-azatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10-dione.
| Compound Name | (1R,8R,9R)-8-(4-methoxyphenyl)-11-oxa-2,6-dithia-4-azatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10-dione |
|---|---|
| PubChem CID | 132941903 |
| Molecular Formula | C15H13NO4S2 |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.03 |
| IUPAC Name | (1R,8R,9R)-8-(4-methoxyphenyl)-11-oxa-2,6-dithia-4-azatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10-dione |
| SMILES | COc1ccc([C@@H]2c3sc(=O)[nH]c3S[C@H]3COC(=O)[C@@H]23)cc1 |
| InChI | InChI=1S/C15H13NO4S2/c1-19-8-4-2-7(3-5-8)10-11-9(6-20-14(11)17)21-13-12(10)22-15(18)16-13/h2-5,9-11H,6H2,1H3,(H,16,18)/t9-,10-,11+/m0/s1 |
| InChIKey | GYNYKQWCUAPGME-GARJFASQSA-N |
| XLogP | 2.22 |
| TPSA | 68.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'} |
|---|