C25H22NO5S2- — CID 4193109
7-(4-methoxyphenyl)-2-oxo-6-(5,6,7,8-tetrahydronaphthalene-1-carbonyl)-3,5,6,7-tetrahydrothiopyrano[2,3-d][1,3]thiazole-5-carboxylate (PubChem CID 4193109) has the molecular formula C25H22NO5S2- and a molecular weight of 480.59 g/mol. Its IUPAC name is 7-(4-methoxyphenyl)-2-oxo-6-(5,6,7,8-tetrahydronaphthalene-1-carbonyl)-3,5,6,7-tetrahydrothiopyrano[2,3-d][1,3]thiazole-5-carboxylate.
| Compound Name | 7-(4-methoxyphenyl)-2-oxo-6-(5,6,7,8-tetrahydronaphthalene-1-carbonyl)-3,5,6,7-tetrahydrothiopyrano[2,3-d][1,3]thiazole-5-carboxylate |
|---|---|
| PubChem CID | 4193109 |
| Molecular Formula | C25H22NO5S2- |
| Molecular Weight | 480.59 g/mol |
| Exact Mass | 480.09 |
| IUPAC Name | 7-(4-methoxyphenyl)-2-oxo-6-(5,6,7,8-tetrahydronaphthalene-1-carbonyl)-3,5,6,7-tetrahydrothiopyrano[2,3-d][1,3]thiazole-5-carboxylate |
| SMILES | COc1ccc(C2c3sc(=O)[nH]c3SC(C(=O)[O-])C2C(=O)c2cccc3c2CCCC3)cc1 |
| InChI | InChI=1S/C25H23NO5S2/c1-31-15-11-9-14(10-12-15)18-19(22(24(28)29)32-23-21(18)33-25(30)26-23)20(27)17-8-4-6-13-5-2-3-7-16(13)17/h4,6,8-12,18-19,22H,2-3,5,7H2,1H3,(H,26,30)(H,28,29)/p-1 |
| InChIKey | CXOXMHMDZVNXID-UHFFFAOYSA-M |
| XLogP | 3.18 |
| TPSA | 99.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.59 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'} |
|---|