C18H19NO6S3 — CID 18866019
dimethyl 7-(3,4-dimethoxyphenyl)-2-sulfanylidene-3,5,6,7-tetrahydrothiopyrano[2,3-d][1,3]thiazole-5,6-dicarboxylate (PubChem CID 18866019) has the molecular formula C18H19NO6S3 and a molecular weight of 441.55 g/mol. Its IUPAC name is dimethyl 7-(3,4-dimethoxyphenyl)-2-sulfanylidene-3,5,6,7-tetrahydrothiopyrano[2,3-d][1,3]thiazole-5,6-dicarboxylate.
| Compound Name | dimethyl 7-(3,4-dimethoxyphenyl)-2-sulfanylidene-3,5,6,7-tetrahydrothiopyrano[2,3-d][1,3]thiazole-5,6-dicarboxylate |
|---|---|
| PubChem CID | 18866019 |
| Molecular Formula | C18H19NO6S3 |
| Molecular Weight | 441.55 g/mol |
| Exact Mass | 441.04 |
| IUPAC Name | dimethyl 7-(3,4-dimethoxyphenyl)-2-sulfanylidene-3,5,6,7-tetrahydrothiopyrano[2,3-d][1,3]thiazole-5,6-dicarboxylate |
| SMILES | COC(=O)C1Sc2[nH]c(=S)sc2C(c2ccc(OC)c(OC)c2)C1C(=O)OC |
| InChI | InChI=1S/C18H19NO6S3/c1-22-9-6-5-8(7-10(9)23-2)11-12(16(20)24-3)14(17(21)25-4)27-15-13(11)28-18(26)19-15/h5-7,11-12,14H,1-4H3,(H,19,26) |
| InChIKey | GAGCWFCLYPISOZ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 86.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.55 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|