C15H15NO5S2 — CID 1385101
methyl (6R,7S)-7-(4-hydroxy-3-methoxyphenyl)-2-oxo-3,5,6,7-tetrahydrothiopyrano[2,3-d][1,3]thiazole-6-carboxylate (PubChem CID 1385101) has the molecular formula C15H15NO5S2 and a molecular weight of 353.42 g/mol. Its IUPAC name is methyl (6R,7S)-7-(4-hydroxy-3-methoxyphenyl)-2-oxo-3,5,6,7-tetrahydrothiopyrano[2,3-d][1,3]thiazole-6-carboxylate.
| Compound Name | methyl (6R,7S)-7-(4-hydroxy-3-methoxyphenyl)-2-oxo-3,5,6,7-tetrahydrothiopyrano[2,3-d][1,3]thiazole-6-carboxylate |
|---|---|
| PubChem CID | 1385101 |
| Molecular Formula | C15H15NO5S2 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.04 |
| IUPAC Name | methyl (6R,7S)-7-(4-hydroxy-3-methoxyphenyl)-2-oxo-3,5,6,7-tetrahydrothiopyrano[2,3-d][1,3]thiazole-6-carboxylate |
| SMILES | COC(=O)[C@@H]1CSc2[nH]c(=O)sc2[C@@H]1c1ccc(O)c(OC)c1 |
| InChI | InChI=1S/C15H15NO5S2/c1-20-10-5-7(3-4-9(10)17)11-8(14(18)21-2)6-22-13-12(11)23-15(19)16-13/h3-5,8,11,17H,6H2,1-2H3,(H,16,19)/t8-,11-/m1/s1 |
| InChIKey | IRKVTFDZQUAXJS-LDYMZIIASA-N |
| XLogP | 2.18 |
| TPSA | 88.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'} |
|---|