C22H21NO5S2 — CID 75465178
5-(3,4-dimethoxyphenyl)-7-(4-methylphenyl)-2-oxo-3,5,6,7-tetrahydrothiopyrano[2,3-d][1,3]thiazole-6-carboxylic acid (PubChem CID 75465178) has the molecular formula C22H21NO5S2 and a molecular weight of 443.55 g/mol. Its IUPAC name is 5-(3,4-dimethoxyphenyl)-7-(4-methylphenyl)-2-oxo-3,5,6,7-tetrahydrothiopyrano[2,3-d][1,3]thiazole-6-carboxylic acid.
| Compound Name | 5-(3,4-dimethoxyphenyl)-7-(4-methylphenyl)-2-oxo-3,5,6,7-tetrahydrothiopyrano[2,3-d][1,3]thiazole-6-carboxylic acid |
|---|---|
| PubChem CID | 75465178 |
| Molecular Formula | C22H21NO5S2 |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.09 |
| IUPAC Name | 5-(3,4-dimethoxyphenyl)-7-(4-methylphenyl)-2-oxo-3,5,6,7-tetrahydrothiopyrano[2,3-d][1,3]thiazole-6-carboxylic acid |
| SMILES | COc1ccc(C2Sc3[nH]c(=O)sc3C(c3ccc(C)cc3)C2C(=O)O)cc1OC |
| InChI | InChI=1S/C22H21NO5S2/c1-11-4-6-12(7-5-11)16-17(21(24)25)18(29-20-19(16)30-22(26)23-20)13-8-9-14(27-2)15(10-13)28-3/h4-10,16-18H,1-3H3,(H,23,26)(H,24,25) |
| InChIKey | XKIJYWAZUACIJH-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 88.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'} |
|---|