C18H19NO2S3 — CID 18865721
9-(3-hydroxy-4-methoxyphenyl)-3,7-dithia-5-azatetracyclo[9.2.1.02,10.04,8]tetradec-4(8)-ene-6-thione (PubChem CID 18865721) has the molecular formula C18H19NO2S3 and a molecular weight of 377.56 g/mol. Its IUPAC name is 9-(3-hydroxy-4-methoxyphenyl)-3,7-dithia-5-azatetracyclo[9.2.1.02,10.04,8]tetradec-4(8)-ene-6-thione.
| Compound Name | 9-(3-hydroxy-4-methoxyphenyl)-3,7-dithia-5-azatetracyclo[9.2.1.02,10.04,8]tetradec-4(8)-ene-6-thione |
|---|---|
| PubChem CID | 18865721 |
| Molecular Formula | C18H19NO2S3 |
| Molecular Weight | 377.56 g/mol |
| Exact Mass | 377.06 |
| IUPAC Name | 9-(3-hydroxy-4-methoxyphenyl)-3,7-dithia-5-azatetracyclo[9.2.1.02,10.04,8]tetradec-4(8)-ene-6-thione |
| SMILES | COc1ccc(C2c3sc(=S)[nH]c3SC3C4CCC(C4)C23)cc1O |
| InChI | InChI=1S/C18H19NO2S3/c1-21-12-5-4-9(7-11(12)20)14-13-8-2-3-10(6-8)15(13)23-17-16(14)24-18(22)19-17/h4-5,7-8,10,13-15,20H,2-3,6H2,1H3,(H,19,22) |
| InChIKey | PIZCLAPAPQQBMT-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 45.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.56 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|