C25H25NO3S2 — CID 99736769
(1R,2R,9R,10R,11S)-9-(3-methoxy-4-phenylmethoxyphenyl)-3,7-dithia-5-azatetracyclo[9.2.1.02,10.04,8]tetradec-4(8)-en-6-one (PubChem CID 99736769) has the molecular formula C25H25NO3S2 and a molecular weight of 451.61 g/mol. Its IUPAC name is (1R,2R,9R,10R,11S)-9-(3-methoxy-4-phenylmethoxyphenyl)-3,7-dithia-5-azatetracyclo[9.2.1.02,10.04,8]tetradec-4(8)-en-6-one.
| Compound Name | (1R,2R,9R,10R,11S)-9-(3-methoxy-4-phenylmethoxyphenyl)-3,7-dithia-5-azatetracyclo[9.2.1.02,10.04,8]tetradec-4(8)-en-6-one |
|---|---|
| PubChem CID | 99736769 |
| Molecular Formula | C25H25NO3S2 |
| Molecular Weight | 451.61 g/mol |
| Exact Mass | 451.13 |
| IUPAC Name | (1R,2R,9R,10R,11S)-9-(3-methoxy-4-phenylmethoxyphenyl)-3,7-dithia-5-azatetracyclo[9.2.1.02,10.04,8]tetradec-4(8)-en-6-one |
| SMILES | COc1cc([C@@H]2c3sc(=O)[nH]c3S[C@@H]3[C@@H]4CC[C@@H](C4)[C@H]23)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C25H25NO3S2/c1-28-19-12-16(9-10-18(19)29-13-14-5-3-2-4-6-14)21-20-15-7-8-17(11-15)22(20)30-24-23(21)31-25(27)26-24/h2-6,9-10,12,15,17,20-22H,7-8,11,13H2,1H3,(H,26,27)/t15-,17+,20+,21-,22+/m0/s1 |
| InChIKey | WMYNNKDBHMSULI-BJTLBUAJSA-N |
| XLogP | 5.68 |
| TPSA | 51.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.61 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'} |
|---|