C19H21NO4S2 — CID 124710997
(1S,2S,9R,10R,11S)-9-(4-hydroxy-3,5-dimethoxyphenyl)-3,7-dithia-5-azatetracyclo[9.2.1.02,10.04,8]tetradec-4(8)-en-6-one (PubChem CID 124710997) has the molecular formula C19H21NO4S2 and a molecular weight of 391.51 g/mol. Its IUPAC name is (1S,2S,9R,10R,11S)-9-(4-hydroxy-3,5-dimethoxyphenyl)-3,7-dithia-5-azatetracyclo[9.2.1.02,10.04,8]tetradec-4(8)-en-6-one.
| Compound Name | (1S,2S,9R,10R,11S)-9-(4-hydroxy-3,5-dimethoxyphenyl)-3,7-dithia-5-azatetracyclo[9.2.1.02,10.04,8]tetradec-4(8)-en-6-one |
|---|---|
| PubChem CID | 124710997 |
| Molecular Formula | C19H21NO4S2 |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.09 |
| IUPAC Name | (1S,2S,9R,10R,11S)-9-(4-hydroxy-3,5-dimethoxyphenyl)-3,7-dithia-5-azatetracyclo[9.2.1.02,10.04,8]tetradec-4(8)-en-6-one |
| SMILES | COc1cc([C@@H]2c3sc(=O)[nH]c3S[C@H]3[C@H]4CC[C@@H](C4)[C@H]23)cc(OC)c1O |
| InChI | InChI=1S/C19H21NO4S2/c1-23-11-6-10(7-12(24-2)15(11)21)14-13-8-3-4-9(5-8)16(13)25-18-17(14)26-19(22)20-18/h6-9,13-14,16,21H,3-5H2,1-2H3,(H,20,22)/t8-,9-,13+,14-,16-/m0/s1 |
| InChIKey | CFBIVVPQSCMBOS-IGQXCVHRSA-N |
| XLogP | 3.81 |
| TPSA | 71.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'} |
|---|