C25H24ClNO3S2 — CID 124769436
(1S,2R,9R,10S,11S)-9-[4-[(3-chlorophenyl)methoxy]-3-methoxyphenyl]-3,7-dithia-5-azatetracyclo[9.2.1.02,10.04,8]tetradec-4(8)-en-6-one (PubChem CID 124769436) has the molecular formula C25H24ClNO3S2 and a molecular weight of 486.06 g/mol. Its IUPAC name is (1S,2R,9R,10S,11S)-9-[4-[(3-chlorophenyl)methoxy]-3-methoxyphenyl]-3,7-dithia-5-azatetracyclo[9.2.1.02,10.04,8]tetradec-4(8)-en-6-one.
| Compound Name | (1S,2R,9R,10S,11S)-9-[4-[(3-chlorophenyl)methoxy]-3-methoxyphenyl]-3,7-dithia-5-azatetracyclo[9.2.1.02,10.04,8]tetradec-4(8)-en-6-one |
|---|---|
| PubChem CID | 124769436 |
| Molecular Formula | C25H24ClNO3S2 |
| Molecular Weight | 486.06 g/mol |
| Exact Mass | 485.09 |
| IUPAC Name | (1S,2R,9R,10S,11S)-9-[4-[(3-chlorophenyl)methoxy]-3-methoxyphenyl]-3,7-dithia-5-azatetracyclo[9.2.1.02,10.04,8]tetradec-4(8)-en-6-one |
| SMILES | COc1cc([C@@H]2c3sc(=O)[nH]c3S[C@@H]3[C@H]4CC[C@@H](C4)[C@@H]23)ccc1OCc1cccc(Cl)c1 |
| InChI | InChI=1S/C25H24ClNO3S2/c1-29-19-11-15(7-8-18(19)30-12-13-3-2-4-17(26)9-13)21-20-14-5-6-16(10-14)22(20)31-24-23(21)32-25(28)27-24/h2-4,7-9,11,14,16,20-22H,5-6,10,12H2,1H3,(H,27,28)/t14-,16-,20-,21-,22+/m0/s1 |
| InChIKey | VMLMMWGSJCHEAD-VRYVMVSQSA-N |
| XLogP | 6.33 |
| TPSA | 51.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.06 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'} |
|---|