C15H12F3N3O3S2 — CID 99050496
(5S,6R,7S)-2-oxo-7-[4-(trifluoromethyl)phenyl]-3,5,6,7-tetrahydrothiopyrano[2,3-d][1,3]thiazole-5,6-dicarboxamide (PubChem CID 99050496) has the molecular formula C15H12F3N3O3S2 and a molecular weight of 403.41 g/mol. Its IUPAC name is (5S,6R,7S)-2-oxo-7-[4-(trifluoromethyl)phenyl]-3,5,6,7-tetrahydrothiopyrano[2,3-d][1,3]thiazole-5,6-dicarboxamide.
| Compound Name | (5S,6R,7S)-2-oxo-7-[4-(trifluoromethyl)phenyl]-3,5,6,7-tetrahydrothiopyrano[2,3-d][1,3]thiazole-5,6-dicarboxamide |
|---|---|
| PubChem CID | 99050496 |
| Molecular Formula | C15H12F3N3O3S2 |
| Molecular Weight | 403.41 g/mol |
| Exact Mass | 403.03 |
| IUPAC Name | (5S,6R,7S)-2-oxo-7-[4-(trifluoromethyl)phenyl]-3,5,6,7-tetrahydrothiopyrano[2,3-d][1,3]thiazole-5,6-dicarboxamide |
| SMILES | NC(=O)[C@H]1[C@@H](c2ccc(C(F)(F)F)cc2)c2sc(=O)[nH]c2S[C@@H]1C(N)=O |
| InChI | InChI=1S/C15H12F3N3O3S2/c16-15(17,18)6-3-1-5(2-4-6)7-8(11(19)22)9(12(20)23)25-13-10(7)26-14(24)21-13/h1-4,7-9H,(H2,19,22)(H2,20,23)(H,21,24)/t7-,8+,9+/m1/s1 |
| InChIKey | MMUPTPZBDNUGPH-VGMNWLOBSA-N |
| XLogP | 1.65 |
| TPSA | 119.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.41 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'} |
|---|