C18H16F3NOS2 — CID 98186063
(1R,2S,9R,10R,11R)-9-[4-(trifluoromethyl)phenyl]-3,7-dithia-5-azatetracyclo[9.2.1.02,10.04,8]tetradec-4(8)-en-6-one (PubChem CID 98186063) has the molecular formula C18H16F3NOS2 and a molecular weight of 383.46 g/mol. Its IUPAC name is (1R,2S,9R,10R,11R)-9-[4-(trifluoromethyl)phenyl]-3,7-dithia-5-azatetracyclo[9.2.1.02,10.04,8]tetradec-4(8)-en-6-one.
| Compound Name | (1R,2S,9R,10R,11R)-9-[4-(trifluoromethyl)phenyl]-3,7-dithia-5-azatetracyclo[9.2.1.02,10.04,8]tetradec-4(8)-en-6-one |
|---|---|
| PubChem CID | 98186063 |
| Molecular Formula | C18H16F3NOS2 |
| Molecular Weight | 383.46 g/mol |
| Exact Mass | 383.06 |
| IUPAC Name | (1R,2S,9R,10R,11R)-9-[4-(trifluoromethyl)phenyl]-3,7-dithia-5-azatetracyclo[9.2.1.02,10.04,8]tetradec-4(8)-en-6-one |
| SMILES | O=c1[nH]c2c(s1)[C@@H](c1ccc(C(F)(F)F)cc1)[C@H]1[C@@H]3CC[C@H](C3)[C@@H]1S2 |
| InChI | InChI=1S/C18H16F3NOS2/c19-18(20,21)11-5-3-8(4-6-11)12-13-9-1-2-10(7-9)14(13)24-16-15(12)25-17(23)22-16/h3-6,9-10,12-14H,1-2,7H2,(H,22,23)/t9-,10-,12+,13-,14+/m1/s1 |
| InChIKey | NOUAOHKFTLZQIJ-TZNMXHEESA-N |
| XLogP | 5.11 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.46 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'} |
|---|