C13H10N2O5S2 — CID 39840554
(1S,9R,10S)-9-hydroxy-4-nitro-8-oxa-12,16-dithia-14-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2(7),3,5,13(17)-tetraen-15-one (PubChem CID 39840554) has the molecular formula C13H10N2O5S2 and a molecular weight of 338.37 g/mol. Its IUPAC name is (1S,9R,10S)-9-hydroxy-4-nitro-8-oxa-12,16-dithia-14-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2(7),3,5,13(17)-tetraen-15-one.
| Compound Name | (1S,9R,10S)-9-hydroxy-4-nitro-8-oxa-12,16-dithia-14-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2(7),3,5,13(17)-tetraen-15-one |
|---|---|
| PubChem CID | 39840554 |
| Molecular Formula | C13H10N2O5S2 |
| Molecular Weight | 338.37 g/mol |
| Exact Mass | 338.00 |
| IUPAC Name | (1S,9R,10S)-9-hydroxy-4-nitro-8-oxa-12,16-dithia-14-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2(7),3,5,13(17)-tetraen-15-one |
| SMILES | O=c1[nH]c2c(s1)[C@@H]1c3cc([N+](=O)[O-])ccc3O[C@@H](O)[C@H]1CS2 |
| InChI | InChI=1S/C13H10N2O5S2/c16-12-7-4-21-11-10(22-13(17)14-11)9(7)6-3-5(15(18)19)1-2-8(6)20-12/h1-3,7,9,12,16H,4H2,(H,14,17)/t7-,9+,12+/m0/s1 |
| InChIKey | RJEFWXGTPVRTJC-LPBBDHJYSA-N |
| XLogP | 1.91 |
| TPSA | 105.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.37 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|