C10H11NO6S — CID 102567548
3-ethylsulfonyl-5-nitro-2,3-dihydro-1-benzofuran-2-ol (PubChem CID 102567548) has the molecular formula C10H11NO6S and a molecular weight of 273.27 g/mol. Its IUPAC name is 3-ethylsulfonyl-5-nitro-2,3-dihydro-1-benzofuran-2-ol.
| Compound Name | 3-ethylsulfonyl-5-nitro-2,3-dihydro-1-benzofuran-2-ol |
|---|---|
| PubChem CID | 102567548 |
| Molecular Formula | C10H11NO6S |
| Molecular Weight | 273.27 g/mol |
| Exact Mass | 273.03 |
| IUPAC Name | 3-ethylsulfonyl-5-nitro-2,3-dihydro-1-benzofuran-2-ol |
| SMILES | CCS(=O)(=O)C1c2cc([N+](=O)[O-])ccc2OC1O |
| InChI | InChI=1S/C10H11NO6S/c1-2-18(15,16)9-7-5-6(11(13)14)3-4-8(7)17-10(9)12/h3-5,9-10,12H,2H2,1H3 |
| InChIKey | GAQNQYLJSHSDHX-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 106.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.27 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|