C16H22N2O6 — CID 70529718
ethyl N-(3-hydroxy-2-methyl-6-nitro-3,4-dihydro-2H-chromen-4-yl)-N-propylcarbamate (PubChem CID 70529718) has the molecular formula C16H22N2O6 and a molecular weight of 338.36 g/mol. Its IUPAC name is ethyl N-(3-hydroxy-2-methyl-6-nitro-3,4-dihydro-2H-chromen-4-yl)-N-propylcarbamate.
| Compound Name | ethyl N-(3-hydroxy-2-methyl-6-nitro-3,4-dihydro-2H-chromen-4-yl)-N-propylcarbamate |
|---|---|
| PubChem CID | 70529718 |
| Molecular Formula | C16H22N2O6 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | ethyl N-(3-hydroxy-2-methyl-6-nitro-3,4-dihydro-2H-chromen-4-yl)-N-propylcarbamate |
| SMILES | CCCN(C(=O)OCC)C1c2cc([N+](=O)[O-])ccc2OC(C)C1O |
| InChI | InChI=1S/C16H22N2O6/c1-4-8-17(16(20)23-5-2)14-12-9-11(18(21)22)6-7-13(12)24-10(3)15(14)19/h6-7,9-10,14-15,19H,4-5,8H2,1-3H3 |
| InChIKey | FUQMLYSOEGBQHD-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 102.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|