C10H9NO4 — CID 45093035
(1R,2S)-7-nitro-1,2-dihydronaphthalene-1,2-diol (PubChem CID 45093035) has the molecular formula C10H9NO4 and a molecular weight of 207.19 g/mol. Its IUPAC name is (1R,2S)-7-nitro-1,2-dihydronaphthalene-1,2-diol.
| Compound Name | (1R,2S)-7-nitro-1,2-dihydronaphthalene-1,2-diol |
|---|---|
| PubChem CID | 45093035 |
| Molecular Formula | C10H9NO4 |
| Molecular Weight | 207.19 g/mol |
| Exact Mass | 207.05 |
| IUPAC Name | (1R,2S)-7-nitro-1,2-dihydronaphthalene-1,2-diol |
| SMILES | O=[N+]([O-])c1ccc2c(c1)[C@@H](O)[C@@H](O)C=C2 |
| InChI | InChI=1S/C10H9NO4/c12-9-4-2-6-1-3-7(11(14)15)5-8(6)10(9)13/h1-5,9-10,12-13H/t9-,10+/m0/s1 |
| InChIKey | OHVAUDNYSVJIAA-VHSXEESVSA-N |
| XLogP | 1.02 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.19 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|