C8H6N2O4 — CID 61361847
3-hydroxy-5-nitro-1,3-dihydroindol-2-one (PubChem CID 61361847) has the molecular formula C8H6N2O4 and a molecular weight of 194.15 g/mol. Its IUPAC name is 3-hydroxy-5-nitro-1,3-dihydroindol-2-one.
| Compound Name | 3-hydroxy-5-nitro-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 61361847 |
| Molecular Formula | C8H6N2O4 |
| Molecular Weight | 194.15 g/mol |
| Exact Mass | 194.03 |
| IUPAC Name | 3-hydroxy-5-nitro-1,3-dihydroindol-2-one |
| SMILES | O=C1Nc2ccc([N+](=O)[O-])cc2C1O |
| InChI | InChI=1S/C8H6N2O4/c11-7-5-3-4(10(13)14)1-2-6(5)9-8(7)12/h1-3,7,11H,(H,9,12) |
| InChIKey | KIXIVPGTXLUMED-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.15 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|