C10H9N3O4 — CID 4860868
3-methyl-7-nitro-3,4-dihydro-1H-1,4-benzodiazepine-2,5-dione (PubChem CID 4860868) has the molecular formula C10H9N3O4 and a molecular weight of 235.20 g/mol. Its IUPAC name is 3-methyl-7-nitro-3,4-dihydro-1H-1,4-benzodiazepine-2,5-dione.
| Compound Name | 3-methyl-7-nitro-3,4-dihydro-1H-1,4-benzodiazepine-2,5-dione |
|---|---|
| PubChem CID | 4860868 |
| Molecular Formula | C10H9N3O4 |
| Molecular Weight | 235.20 g/mol |
| Exact Mass | 235.06 |
| IUPAC Name | 3-methyl-7-nitro-3,4-dihydro-1H-1,4-benzodiazepine-2,5-dione |
| SMILES | CC1NC(=O)c2cc([N+](=O)[O-])ccc2NC1=O |
| InChI | InChI=1S/C10H9N3O4/c1-5-9(14)12-8-3-2-6(13(16)17)4-7(8)10(15)11-5/h2-5H,1H3,(H,11,15)(H,12,14) |
| InChIKey | WBRUADDDFSJEGU-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.20 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|