C13H10N4O3 — CID 45113124
6-nitro-2-pyridin-4-yl-2,3-dihydro-1H-quinazolin-4-one (PubChem CID 45113124) has the molecular formula C13H10N4O3 and a molecular weight of 270.25 g/mol. Its IUPAC name is 6-nitro-2-pyridin-4-yl-2,3-dihydro-1H-quinazolin-4-one.
| Compound Name | 6-nitro-2-pyridin-4-yl-2,3-dihydro-1H-quinazolin-4-one |
|---|---|
| PubChem CID | 45113124 |
| Molecular Formula | C13H10N4O3 |
| Molecular Weight | 270.25 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | 6-nitro-2-pyridin-4-yl-2,3-dihydro-1H-quinazolin-4-one |
| SMILES | O=C1NC(c2ccncc2)Nc2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C13H10N4O3/c18-13-10-7-9(17(19)20)1-2-11(10)15-12(16-13)8-3-5-14-6-4-8/h1-7,12,15H,(H,16,18) |
| InChIKey | VERQSFCLFFKUCN-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 97.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.25 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|