C16H16N2O4S — CID 172562177
ethane;2-(4-hydroxyphenyl)-6-nitro-2,3-dihydro-1,3-benzothiazin-4-one (PubChem CID 172562177) has the molecular formula C16H16N2O4S and a molecular weight of 332.38 g/mol. Its IUPAC name is ethane;2-(4-hydroxyphenyl)-6-nitro-2,3-dihydro-1,3-benzothiazin-4-one.
| Compound Name | ethane;2-(4-hydroxyphenyl)-6-nitro-2,3-dihydro-1,3-benzothiazin-4-one |
|---|---|
| PubChem CID | 172562177 |
| Molecular Formula | C16H16N2O4S |
| Molecular Weight | 332.38 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | ethane;2-(4-hydroxyphenyl)-6-nitro-2,3-dihydro-1,3-benzothiazin-4-one |
| SMILES | CC.O=C1NC(c2ccc(O)cc2)Sc2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C14H10N2O4S.C2H6/c17-10-4-1-8(2-5-10)14-15-13(18)11-7-9(16(19)20)3-6-12(11)21-14;1-2/h1-7,14,17H,(H,15,18);1-2H3 |
| InChIKey | PTBMEWDLEZMEDU-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.38 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|