C11H12N4O4S — CID 161468785
(3R)-9-nitro-7-oxo-3,4,5,6-tetrahydro-2H-1,4,6-benzothiadiazonine-3-carboxamide (PubChem CID 161468785) has the molecular formula C11H12N4O4S and a molecular weight of 296.31 g/mol. Its IUPAC name is (3R)-9-nitro-7-oxo-3,4,5,6-tetrahydro-2H-1,4,6-benzothiadiazonine-3-carboxamide.
| Compound Name | (3R)-9-nitro-7-oxo-3,4,5,6-tetrahydro-2H-1,4,6-benzothiadiazonine-3-carboxamide |
|---|---|
| PubChem CID | 161468785 |
| Molecular Formula | C11H12N4O4S |
| Molecular Weight | 296.31 g/mol |
| Exact Mass | 296.06 |
| IUPAC Name | (3R)-9-nitro-7-oxo-3,4,5,6-tetrahydro-2H-1,4,6-benzothiadiazonine-3-carboxamide |
| SMILES | NC(=O)[C@@H]1CSc2ccc([N+](=O)[O-])cc2C(=O)NCN1 |
| InChI | InChI=1S/C11H12N4O4S/c12-10(16)8-4-20-9-2-1-6(15(18)19)3-7(9)11(17)14-5-13-8/h1-3,8,13H,4-5H2,(H2,12,16)(H,14,17)/t8-/m0/s1 |
| InChIKey | WCUICYOMPSCPBP-QMMMGPOBSA-N |
| XLogP | -0.17 |
| TPSA | 127.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.31 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|