C22H27F3N6O7S — CID 59997594
(4R,10S)-7-(3-amino-3-oxopropyl)-15-nitro-6,9,12-trioxo-10-(5,5,5-trifluoropentyl)-2-thia-5,8,11-triazabicyclo[11.4.0]heptadeca-1(13),14,16-triene-4-carboxamide (PubChem CID 59997594) has the molecular formula C22H27F3N6O7S and a molecular weight of 576.55 g/mol. Its IUPAC name is (4R,10S)-7-(3-amino-3-oxopropyl)-15-nitro-6,9,12-trioxo-10-(5,5,5-trifluoropentyl)-2-thia-5,8,11-triazabicyclo[11.4.0]heptadeca-1(13),14,16-triene-4-carboxamide.
| Compound Name | (4R,10S)-7-(3-amino-3-oxopropyl)-15-nitro-6,9,12-trioxo-10-(5,5,5-trifluoropentyl)-2-thia-5,8,11-triazabicyclo[11.4.0]heptadeca-1(13),14,16-triene-4-carboxamide |
|---|---|
| PubChem CID | 59997594 |
| Molecular Formula | C22H27F3N6O7S |
| Molecular Weight | 576.55 g/mol |
| Exact Mass | 576.16 |
| IUPAC Name | (4R,10S)-7-(3-amino-3-oxopropyl)-15-nitro-6,9,12-trioxo-10-(5,5,5-trifluoropentyl)-2-thia-5,8,11-triazabicyclo[11.4.0]heptadeca-1(13),14,16-triene-4-carboxamide |
| SMILES | NC(=O)CCC1NC(=O)[C@H](CCCCC(F)(F)F)NC(=O)c2cc([N+](=O)[O-])ccc2SC[C@@H](C(N)=O)NC1=O |
| InChI | InChI=1S/C22H27F3N6O7S/c23-22(24,25)8-2-1-3-13-20(35)29-14(5-7-17(26)32)21(36)30-15(18(27)33)10-39-16-6-4-11(31(37)38)9-12(16)19(34)28-13/h4,6,9,13-15H,1-3,5,7-8,10H2,(H2,26,32)(H2,27,33)(H,28,34)(H,29,35)(H,30,36)/t13-,14?,15-/m0/s1 |
| InChIKey | AVMQVTCGXJDGSL-LWEDLAQUSA-N |
| XLogP | 0.64 |
| TPSA | 216.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.55 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|