C25H34N6O10 — CID 20775384
3-[5-(carboxymethylcarbamoyl)-16-nitro-7,10,13-trioxo-8-pentyl-2,6,9,12-tetrazabicyclo[12.4.0]octadeca-1(14),15,17-trien-11-yl]propanoic acid (PubChem CID 20775384) has the molecular formula C25H34N6O10 and a molecular weight of 578.58 g/mol. Its IUPAC name is 3-[5-(carboxymethylcarbamoyl)-16-nitro-7,10,13-trioxo-8-pentyl-2,6,9,12-tetrazabicyclo[12.4.0]octadeca-1(14),15,17-trien-11-yl]propanoic acid.
| Compound Name | 3-[5-(carboxymethylcarbamoyl)-16-nitro-7,10,13-trioxo-8-pentyl-2,6,9,12-tetrazabicyclo[12.4.0]octadeca-1(14),15,17-trien-11-yl]propanoic acid |
|---|---|
| PubChem CID | 20775384 |
| Molecular Formula | C25H34N6O10 |
| Molecular Weight | 578.58 g/mol |
| Exact Mass | 578.23 |
| IUPAC Name | 3-[5-(carboxymethylcarbamoyl)-16-nitro-7,10,13-trioxo-8-pentyl-2,6,9,12-tetrazabicyclo[12.4.0]octadeca-1(14),15,17-trien-11-yl]propanoic acid |
| SMILES | CCCCCC1NC(=O)C(CCC(=O)O)NC(=O)c2cc([N+](=O)[O-])ccc2NCCC(C(=O)NCC(=O)O)NC1=O |
| InChI | InChI=1S/C25H34N6O10/c1-2-3-4-5-17-24(38)30-19(23(37)27-13-21(34)35)10-11-26-16-7-6-14(31(40)41)12-15(16)22(36)28-18(25(39)29-17)8-9-20(32)33/h6-7,12,17-19,26H,2-5,8-11,13H2,1H3,(H,27,37)(H,28,36)(H,29,39)(H,30,38)(H,32,33)(H,34,35) |
| InChIKey | MBDAPNCFJWLTCO-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 246.17 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.58 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|