C23H31N5O9 — CID 59114175
3-[(5S,8S,11S)-5-carbamoyl-16-nitro-7,10,13-trioxo-8-pentyl-2-oxa-6,9,12-triazabicyclo[12.4.0]octadeca-1(14),15,17-trien-11-yl]propanoic acid (PubChem CID 59114175) has the molecular formula C23H31N5O9 and a molecular weight of 521.53 g/mol. Its IUPAC name is 3-[(5S,8S,11S)-5-carbamoyl-16-nitro-7,10,13-trioxo-8-pentyl-2-oxa-6,9,12-triazabicyclo[12.4.0]octadeca-1(14),15,17-trien-11-yl]propanoic acid.
| Compound Name | 3-[(5S,8S,11S)-5-carbamoyl-16-nitro-7,10,13-trioxo-8-pentyl-2-oxa-6,9,12-triazabicyclo[12.4.0]octadeca-1(14),15,17-trien-11-yl]propanoic acid |
|---|---|
| PubChem CID | 59114175 |
| Molecular Formula | C23H31N5O9 |
| Molecular Weight | 521.53 g/mol |
| Exact Mass | 521.21 |
| IUPAC Name | 3-[(5S,8S,11S)-5-carbamoyl-16-nitro-7,10,13-trioxo-8-pentyl-2-oxa-6,9,12-triazabicyclo[12.4.0]octadeca-1(14),15,17-trien-11-yl]propanoic acid |
| SMILES | CCCCC[C@@H]1NC(=O)[C@H](CCC(=O)O)NC(=O)c2cc([N+](=O)[O-])ccc2OCC[C@@H](C(N)=O)NC1=O |
| InChI | InChI=1S/C23H31N5O9/c1-2-3-4-5-16-22(33)25-15(20(24)31)10-11-37-18-8-6-13(28(35)36)12-14(18)21(32)26-17(23(34)27-16)7-9-19(29)30/h6,8,12,15-17H,2-5,7,9-11H2,1H3,(H2,24,31)(H,25,33)(H,26,32)(H,27,34)(H,29,30)/t15-,16-,17-/m0/s1 |
| InChIKey | GTBXDYSBNOKUKF-ULQDDVLXSA-N |
| XLogP | 0.38 |
| TPSA | 220.06 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.53 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|