C21H27N5O9 — CID 15432991
2-[(5S,8S,11S)-8-butan-2-yl-5-carbamoyl-16-nitro-7,10,13-trioxo-2-oxa-6,9,12-triazabicyclo[12.4.0]octadeca-1(14),15,17-trien-11-yl]acetic acid (PubChem CID 15432991) has the molecular formula C21H27N5O9 and a molecular weight of 493.47 g/mol. Its IUPAC name is 2-[(5S,8S,11S)-8-butan-2-yl-5-carbamoyl-16-nitro-7,10,13-trioxo-2-oxa-6,9,12-triazabicyclo[12.4.0]octadeca-1(14),15,17-trien-11-yl]acetic acid.
| Compound Name | 2-[(5S,8S,11S)-8-butan-2-yl-5-carbamoyl-16-nitro-7,10,13-trioxo-2-oxa-6,9,12-triazabicyclo[12.4.0]octadeca-1(14),15,17-trien-11-yl]acetic acid |
|---|---|
| PubChem CID | 15432991 |
| Molecular Formula | C21H27N5O9 |
| Molecular Weight | 493.47 g/mol |
| Exact Mass | 493.18 |
| IUPAC Name | 2-[(5S,8S,11S)-8-butan-2-yl-5-carbamoyl-16-nitro-7,10,13-trioxo-2-oxa-6,9,12-triazabicyclo[12.4.0]octadeca-1(14),15,17-trien-11-yl]acetic acid |
| SMILES | CCC(C)[C@@H]1NC(=O)[C@H](CC(=O)O)NC(=O)c2cc([N+](=O)[O-])ccc2OCC[C@@H](C(N)=O)NC1=O |
| InChI | InChI=1S/C21H27N5O9/c1-3-10(2)17-21(32)23-13(18(22)29)6-7-35-15-5-4-11(26(33)34)8-12(15)19(30)24-14(9-16(27)28)20(31)25-17/h4-5,8,10,13-14,17H,3,6-7,9H2,1-2H3,(H2,22,29)(H,23,32)(H,24,30)(H,25,31)(H,27,28)/t10?,13-,14-,17-/m0/s1 |
| InChIKey | PLLBRWYBSROCEI-RJFZOTLNSA-N |
| XLogP | -0.55 |
| TPSA | 220.06 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.47 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|