C21H29IN6O8 — CID 59114172
(5S,11S)-11-(4-aminobutyl)-8-(1-hydroxyethyl)-18-iodo-16-nitro-7,10,13-trioxo-2-oxa-6,9,12-triazabicyclo[12.4.0]octadeca-1(14),15,17-triene-5-carboxamide (PubChem CID 59114172) has the molecular formula C21H29IN6O8 and a molecular weight of 620.40 g/mol. Its IUPAC name is (5S,11S)-11-(4-aminobutyl)-8-(1-hydroxyethyl)-18-iodo-16-nitro-7,10,13-trioxo-2-oxa-6,9,12-triazabicyclo[12.4.0]octadeca-1(14),15,17-triene-5-carboxamide.
| Compound Name | (5S,11S)-11-(4-aminobutyl)-8-(1-hydroxyethyl)-18-iodo-16-nitro-7,10,13-trioxo-2-oxa-6,9,12-triazabicyclo[12.4.0]octadeca-1(14),15,17-triene-5-carboxamide |
|---|---|
| PubChem CID | 59114172 |
| Molecular Formula | C21H29IN6O8 |
| Molecular Weight | 620.40 g/mol |
| Exact Mass | 620.11 |
| IUPAC Name | (5S,11S)-11-(4-aminobutyl)-8-(1-hydroxyethyl)-18-iodo-16-nitro-7,10,13-trioxo-2-oxa-6,9,12-triazabicyclo[12.4.0]octadeca-1(14),15,17-triene-5-carboxamide |
| SMILES | CC(O)C1NC(=O)[C@H](CCCCN)NC(=O)c2cc([N+](=O)[O-])cc(I)c2OCC[C@@H](C(N)=O)NC1=O |
| InChI | InChI=1S/C21H29IN6O8/c1-10(29)16-21(33)25-14(18(24)30)5-7-36-17-12(8-11(28(34)35)9-13(17)22)19(31)26-15(20(32)27-16)4-2-3-6-23/h8-10,14-16,29H,2-7,23H2,1H3,(H2,24,30)(H,25,33)(H,26,31)(H,27,32)/t10?,14-,15-,16?/m0/s1 |
| InChIKey | DAOVICDTOURCQC-SIBYTZNVSA-N |
| XLogP | -0.95 |
| TPSA | 229.01 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.40 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|