C21H27N5O9S — CID 20775403
7-(4-aminobutyl)-10-(2-carboxyethyl)-15-nitro-6,9,12-trioxo-2-thia-5,8,11-triazabicyclo[11.4.0]heptadeca-1(13),14,16-triene-4-carboxylic acid (PubChem CID 20775403) has the molecular formula C21H27N5O9S and a molecular weight of 525.54 g/mol. Its IUPAC name is 7-(4-aminobutyl)-10-(2-carboxyethyl)-15-nitro-6,9,12-trioxo-2-thia-5,8,11-triazabicyclo[11.4.0]heptadeca-1(13),14,16-triene-4-carboxylic acid.
| Compound Name | 7-(4-aminobutyl)-10-(2-carboxyethyl)-15-nitro-6,9,12-trioxo-2-thia-5,8,11-triazabicyclo[11.4.0]heptadeca-1(13),14,16-triene-4-carboxylic acid |
|---|---|
| PubChem CID | 20775403 |
| Molecular Formula | C21H27N5O9S |
| Molecular Weight | 525.54 g/mol |
| Exact Mass | 525.15 |
| IUPAC Name | 7-(4-aminobutyl)-10-(2-carboxyethyl)-15-nitro-6,9,12-trioxo-2-thia-5,8,11-triazabicyclo[11.4.0]heptadeca-1(13),14,16-triene-4-carboxylic acid |
| SMILES | NCCCCC1NC(=O)C(CCC(=O)O)NC(=O)c2cc([N+](=O)[O-])ccc2SCC(C(=O)O)NC1=O |
| InChI | InChI=1S/C21H27N5O9S/c22-8-2-1-3-13-19(30)25-15(21(32)33)10-36-16-6-4-11(26(34)35)9-12(16)18(29)23-14(20(31)24-13)5-7-17(27)28/h4,6,9,13-15H,1-3,5,7-8,10,22H2,(H,23,29)(H,24,31)(H,25,30)(H,27,28)(H,32,33) |
| InChIKey | GDIWAHOIRYOCLO-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 231.06 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.54 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|